About 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine
2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine (PubChem CID 84621369) has the molecular formula C11H15FN2O
and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine |
| PubChem CID | 84621369 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine |
| SMILES | CC1Nc2cccc(F)c2OC1CCN |
| InChI | InChI=1S/C11H15FN2O/c1-7-10(5-6-13)15-11-8(12)3-2-4-9(11)14-7/h2-4,7,10,14H,5-6,13H2,1H3 |
| InChIKey | LKCQKQWJWJIDNF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine?
The IUPAC name of 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine (CID 84621369) is 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine.
What is the SMILES notation for 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine?
The canonical SMILES for 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine is CC1Nc2cccc(F)c2OC1CCN.
What is the InChIKey of 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine?
The InChIKey is LKCQKQWJWJIDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2O/c1-7-10(5-6-13)15-11-8(12)3-2-4-9(11)14-7/h2-4,7,10,14H,5-6,13H2,1H3.
What are the key properties of 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine?
2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine has a molecular weight of 210.25 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethanamine is sourced from PubChem (CID 84621369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).