C10H12ClNS — CID 84621868
6-chloro-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 84621868) has the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. Its IUPAC name is 6-chloro-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 6-chloro-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84621868 |
| Molecular Formula | C10H12ClNS |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 6-chloro-3,4-dimethyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CC1CSc2ccc(Cl)cc2N1C |
| InChI | InChI=1S/C10H12ClNS/c1-7-6-13-10-4-3-8(11)5-9(10)12(7)2/h3-5,7H,6H2,1-2H3 |
| InChIKey | JDWAGTHAVCZFEF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |