C14H20N2 — CID 84622503
9,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine (PubChem CID 84622503) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 9,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine.
| Compound Name | 9,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
|---|---|
| PubChem CID | 84622503 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 9,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
| SMILES | Cc1cccc2c1N(C)C1CCCCC1N2 |
| InChI | InChI=1S/C14H20N2/c1-10-6-5-8-12-14(10)16(2)13-9-4-3-7-11(13)15-12/h5-6,8,11,13,15H,3-4,7,9H2,1-2H3 |
| InChIKey | RWTHKYPMQONWJO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |