C13H18N2O — CID 84622894
4-(2-aminoethyl)-1,6-dimethyl-3,4-dihydroquinolin-2-one (PubChem CID 84622894) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,6-dimethyl-3,4-dihydroquinolin-2-one.
| Compound Name | 4-(2-aminoethyl)-1,6-dimethyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 84622894 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-(2-aminoethyl)-1,6-dimethyl-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc2c(c1)C(CCN)CC(=O)N2C |
| InChI | InChI=1S/C13H18N2O/c1-9-3-4-12-11(7-9)10(5-6-14)8-13(16)15(12)2/h3-4,7,10H,5-6,8,14H2,1-2H3 |
| InChIKey | MKLSWXRJFJUDFZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |