About 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine
2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine (PubChem CID 84623134) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine |
| PubChem CID | 84623134 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine |
| SMILES | CNCCC1CCN(C)c2ccc(C)cc21 |
| InChI | InChI=1S/C14H22N2/c1-11-4-5-14-13(10-11)12(6-8-15-2)7-9-16(14)3/h4-5,10,12,15H,6-9H2,1-3H3 |
| InChIKey | ZWSDFDBFYBSCOB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine?
The IUPAC name of 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine (CID 84623134) is 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine.
What is the SMILES notation for 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine?
The canonical SMILES for 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine is CNCCC1CCN(C)c2ccc(C)cc21.
What is the InChIKey of 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine?
The InChIKey is ZWSDFDBFYBSCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-11-4-5-14-13(10-11)12(6-8-15-2)7-9-16(14)3/h4-5,10,12,15H,6-9H2,1-3H3.
What are the key properties of 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine?
2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine has a molecular weight of 218.34 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl)-N-methylethanamine is sourced from PubChem (CID 84623134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).