About 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane]
7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] (PubChem CID 84623646) has the molecular formula C13H17FN2
and a molecular weight of 220.29 g/mol. Its IUPAC name is 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane].
Molecular Properties
| Compound Name | 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] |
| PubChem CID | 84623646 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] |
| SMILES | CN1CC2(CCCC2)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C13H17FN2/c1-16-9-13(6-2-3-7-13)15-11-8-10(14)4-5-12(11)16/h4-5,8,15H,2-3,6-7,9H2,1H3 |
| InChIKey | WPJPEWHKIXGFDI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane]?
The IUPAC name of 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] (CID 84623646) is 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane].
What is the SMILES notation for 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane]?
The canonical SMILES for 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] is CN1CC2(CCCC2)Nc2cc(F)ccc21.
What is the InChIKey of 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane]?
The InChIKey is WPJPEWHKIXGFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2/c1-16-9-13(6-2-3-7-13)15-11-8-10(14)4-5-12(11)16/h4-5,8,15H,2-3,6-7,9H2,1H3.
What are the key properties of 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane]?
7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] has a molecular weight of 220.29 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methylspiro[1,3-dihydroquinoxaline-2,1'-cyclopentane] is sourced from PubChem (CID 84623646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).