C13H20N2O — CID 84623666
1-(6-methoxy-1-methyl-3,4-dihydro-2H-quinolin-2-yl)-N-methylmethanamine (PubChem CID 84623666) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(6-methoxy-1-methyl-3,4-dihydro-2H-quinolin-2-yl)-N-methylmethanamine.
| Compound Name | 1-(6-methoxy-1-methyl-3,4-dihydro-2H-quinolin-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 84623666 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(6-methoxy-1-methyl-3,4-dihydro-2H-quinolin-2-yl)-N-methylmethanamine |
| SMILES | CNCC1CCc2cc(OC)ccc2N1C |
| InChI | InChI=1S/C13H20N2O/c1-14-9-11-5-4-10-8-12(16-3)6-7-13(10)15(11)2/h6-8,11,14H,4-5,9H2,1-3H3 |
| InChIKey | GXBFUTSXVXXAKC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|