About 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine
2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine (PubChem CID 84624761) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine |
| PubChem CID | 84624761 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine |
| SMILES | CN1c2cc(Cl)ccc2CCC1CCN |
| InChI | InChI=1S/C12H17ClN2/c1-15-11(6-7-14)5-3-9-2-4-10(13)8-12(9)15/h2,4,8,11H,3,5-7,14H2,1H3 |
| InChIKey | JJEWSGRJMYFZLF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine?
The IUPAC name of 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine (CID 84624761) is 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine.
What is the SMILES notation for 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine?
The canonical SMILES for 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine is CN1c2cc(Cl)ccc2CCC1CCN.
What is the InChIKey of 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine?
The InChIKey is JJEWSGRJMYFZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2/c1-15-11(6-7-14)5-3-9-2-4-10(13)8-12(9)15/h2,4,8,11H,3,5-7,14H2,1H3.
What are the key properties of 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine?
2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine has a molecular weight of 224.73 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine is sourced from PubChem (CID 84624761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).