About 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile
8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile (PubChem CID 84625391) has the molecular formula C12H8N2O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile |
| PubChem CID | 84625391 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile |
| SMILES | Cc1c(C#N)c(=O)[nH]c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C12H8N2O3/c1-6-7-2-10-11(17-5-16-10)3-9(7)14-12(15)8(6)4-13/h2-3H,5H2,1H3,(H,14,15) |
| InChIKey | ZBYFZVSGSMVJNW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The IUPAC name of 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile (CID 84625391) is 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile.
What is the SMILES notation for 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The canonical SMILES for 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile is Cc1c(C#N)c(=O)[nH]c2cc3c(cc12)OCO3.
What is the InChIKey of 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
The InChIKey is ZBYFZVSGSMVJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3/c1-6-7-2-10-11(17-5-16-10)3-9(7)14-12(15)8(6)4-13/h2-3H,5H2,1H3,(H,14,15).
What are the key properties of 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile?
8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile has a molecular weight of 228.21 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbonitrile is sourced from PubChem (CID 84625391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).