C12H11N3O2 — CID 84625789
2,6-dimethyl-3H-imidazo[1,2-a]benzimidazole-1-carboxylic acid (PubChem CID 84625789) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2,6-dimethyl-3H-imidazo[1,2-a]benzimidazole-1-carboxylic acid.
| Compound Name | 2,6-dimethyl-3H-imidazo[1,2-a]benzimidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 84625789 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2,6-dimethyl-3H-imidazo[1,2-a]benzimidazole-1-carboxylic acid |
| SMILES | Cc1ccc2c(c1)nc1[nH]c(C)c(C(=O)O)n12 |
| InChI | InChI=1S/C12H11N3O2/c1-6-3-4-9-8(5-6)14-12-13-7(2)10(11(16)17)15(9)12/h3-5H,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | JNUDFNKYSYXHAN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |