C14H15NO2 — CID 84625850
1,4,5,7-tetramethyl-2-oxoquinoline-3-carbaldehyde (PubChem CID 84625850) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1,4,5,7-tetramethyl-2-oxoquinoline-3-carbaldehyde.
| Compound Name | 1,4,5,7-tetramethyl-2-oxoquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 84625850 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1,4,5,7-tetramethyl-2-oxoquinoline-3-carbaldehyde |
| SMILES | Cc1cc(C)c2c(C)c(C=O)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C14H15NO2/c1-8-5-9(2)13-10(3)11(7-16)14(17)15(4)12(13)6-8/h5-7H,1-4H3 |
| InChIKey | XVXXIKOLOOJWPS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|