C15H22N2 — CID 84626312
3,7,8-trimethyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine (PubChem CID 84626312) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3,7,8-trimethyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine.
| Compound Name | 3,7,8-trimethyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 84626312 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3,7,8-trimethyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine |
| SMILES | Cc1ccc2c(c1C)NCC1CN(C)CCC21 |
| InChI | InChI=1S/C15H22N2/c1-10-4-5-14-13-6-7-17(3)9-12(13)8-16-15(14)11(10)2/h4-5,12-13,16H,6-9H2,1-3H3 |
| InChIKey | JOZZJZMDVFWFLA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |