About 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid
3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid (PubChem CID 84626838) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid |
| PubChem CID | 84626838 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid |
| SMILES | N#Cc1cccc2c1OCC(CCC(=O)O)N2 |
| InChI | InChI=1S/C12H12N2O3/c13-6-8-2-1-3-10-12(8)17-7-9(14-10)4-5-11(15)16/h1-3,9,14H,4-5,7H2,(H,15,16) |
| InChIKey | XPMWYHVWJFEALC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid?
The IUPAC name of 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid (CID 84626838) is 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid.
What is the SMILES notation for 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid?
The canonical SMILES for 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid is N#Cc1cccc2c1OCC(CCC(=O)O)N2.
What is the InChIKey of 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid?
The InChIKey is XPMWYHVWJFEALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c13-6-8-2-1-3-10-12(8)17-7-9(14-10)4-5-11(15)16/h1-3,9,14H,4-5,7H2,(H,15,16).
What are the key properties of 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid?
3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid has a molecular weight of 232.24 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-cyano-3,4-dihydro-2H-1,4-benzoxazin-3-yl)propanoic acid is sourced from PubChem (CID 84626838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).