C13H15FN2O — CID 84627721
9-fluoro-6-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,6]naphthyridin-5-one (PubChem CID 84627721) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 9-fluoro-6-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,6]naphthyridin-5-one.
| Compound Name | 9-fluoro-6-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 84627721 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 9-fluoro-6-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,6]naphthyridin-5-one |
| SMILES | CN1C(=O)C2CCNCC2c2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FN2O/c1-16-12-3-2-8(14)6-10(12)11-7-15-5-4-9(11)13(16)17/h2-3,6,9,11,15H,4-5,7H2,1H3 |
| InChIKey | VHWZJCKHEOEPEL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |