C13H16F2N2 — CID 84629106
7,9-difluoro-10-methyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine (PubChem CID 84629106) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 7,9-difluoro-10-methyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine.
| Compound Name | 7,9-difluoro-10-methyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
|---|---|
| PubChem CID | 84629106 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 7,9-difluoro-10-methyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
| SMILES | CN1c2c(F)cc(F)cc2NC2CCCCC21 |
| InChI | InChI=1S/C13H16F2N2/c1-17-12-5-3-2-4-10(12)16-11-7-8(14)6-9(15)13(11)17/h6-7,10,12,16H,2-5H2,1H3 |
| InChIKey | NCIZJVKBGAHARM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |