About 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline
6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline (PubChem CID 84629808) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline.
Molecular Properties
| Compound Name | 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline |
| PubChem CID | 84629808 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline |
| SMILES | CC1Cc2cc3cc(C(C)(C)C)ccc3nc2N1 |
| InChI | InChI=1S/C16H20N2/c1-10-7-12-8-11-9-13(16(2,3)4)5-6-14(11)18-15(12)17-10/h5-6,8-10H,7H2,1-4H3,(H,17,18) |
| InChIKey | ZGJUMSSHIZRJJF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline?
The IUPAC name of 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline (CID 84629808) is 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline.
What is the SMILES notation for 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline?
The canonical SMILES for 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline is CC1Cc2cc3cc(C(C)(C)C)ccc3nc2N1.
What is the InChIKey of 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline?
The InChIKey is ZGJUMSSHIZRJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2/c1-10-7-12-8-11-9-13(16(2,3)4)5-6-14(11)18-15(12)17-10/h5-6,8-10H,7H2,1-4H3,(H,17,18).
What are the key properties of 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline?
6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline has a molecular weight of 240.35 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-methyl-2,3-dihydro-1H-pyrrolo[2,3-b]quinoline is sourced from PubChem (CID 84629808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).