About 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol
2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol (PubChem CID 84630120) has the molecular formula C11H15NOS2
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol |
| PubChem CID | 84630120 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol |
| SMILES | CSc1ccc2c(c1)SCC(CCO)N2 |
| InChI | InChI=1S/C11H15NOS2/c1-14-9-2-3-10-11(6-9)15-7-8(12-10)4-5-13/h2-3,6,8,12-13H,4-5,7H2,1H3 |
| InChIKey | LLQSFTOZIGKSEE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol?
The IUPAC name of 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol (CID 84630120) is 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol.
What is the SMILES notation for 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol?
The canonical SMILES for 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol is CSc1ccc2c(c1)SCC(CCO)N2.
What is the InChIKey of 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol?
The InChIKey is LLQSFTOZIGKSEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS2/c1-14-9-2-3-10-11(6-9)15-7-8(12-10)4-5-13/h2-3,6,8,12-13H,4-5,7H2,1H3.
What are the key properties of 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol?
2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol has a molecular weight of 241.38 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methylsulfanyl-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol is sourced from PubChem (CID 84630120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).