C15H18N2O — CID 84630313
(4,6-dimethyl-1H-indol-3-yl)-pyrrolidin-2-ylmethanone (PubChem CID 84630313) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (4,6-dimethyl-1H-indol-3-yl)-pyrrolidin-2-ylmethanone.
| Compound Name | (4,6-dimethyl-1H-indol-3-yl)-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 84630313 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (4,6-dimethyl-1H-indol-3-yl)-pyrrolidin-2-ylmethanone |
| SMILES | Cc1cc(C)c2c(C(=O)C3CCCN3)c[nH]c2c1 |
| InChI | InChI=1S/C15H18N2O/c1-9-6-10(2)14-11(8-17-13(14)7-9)15(18)12-4-3-5-16-12/h6-8,12,16-17H,3-5H2,1-2H3 |
| InChIKey | JWFXKPUQQKAYPW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |