C14H18N4 — CID 84630370
(5-tert-butyl-3H-imidazo[1,2-a]benzimidazol-2-yl)methanamine (PubChem CID 84630370) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is (5-tert-butyl-3H-imidazo[1,2-a]benzimidazol-2-yl)methanamine.
| Compound Name | (5-tert-butyl-3H-imidazo[1,2-a]benzimidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 84630370 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (5-tert-butyl-3H-imidazo[1,2-a]benzimidazol-2-yl)methanamine |
| SMILES | CC(C)(C)c1cccc2c1nc1[nH]c(CN)cn12 |
| InChI | InChI=1S/C14H18N4/c1-14(2,3)10-5-4-6-11-12(10)17-13-16-9(7-15)8-18(11)13/h4-6,8H,7,15H2,1-3H3,(H,16,17) |
| InChIKey | XUJBPDDLRVJZJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |