C16H22N2 — CID 84630595
8-ethyl-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine (PubChem CID 84630595) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 8-ethyl-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine.
| Compound Name | 8-ethyl-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine |
|---|---|
| PubChem CID | 84630595 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 8-ethyl-N,9-dimethyl-1,2,3,4-tetrahydrocarbazol-1-amine |
| SMILES | CCc1cccc2c3c(n(C)c12)C(NC)CCC3 |
| InChI | InChI=1S/C16H22N2/c1-4-11-7-5-8-12-13-9-6-10-14(17-2)16(13)18(3)15(11)12/h5,7-8,14,17H,4,6,9-10H2,1-3H3 |
| InChIKey | KLYWAEHLBDXGOQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|