C15H17FN2 — CID 84631314
N-cyclopropyl-8-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 84631314) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is N-cyclopropyl-8-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | N-cyclopropyl-8-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 84631314 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-cyclopropyl-8-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | Fc1cccc2c3c([nH]c12)CCC(NC1CC1)C3 |
| InChI | InChI=1S/C15H17FN2/c16-13-3-1-2-11-12-8-10(17-9-4-5-9)6-7-14(12)18-15(11)13/h1-3,9-10,17-18H,4-8H2 |
| InChIKey | YDVHDXACBISHJN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|