C15H20N2O — CID 84631386
3-(2-amino-2-methylpropyl)-7,8-dimethyl-1H-quinolin-2-one (PubChem CID 84631386) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(2-amino-2-methylpropyl)-7,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-(2-amino-2-methylpropyl)-7,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 84631386 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(2-amino-2-methylpropyl)-7,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(CC(C)(C)N)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C15H20N2O/c1-9-5-6-11-7-12(8-15(3,4)16)14(18)17-13(11)10(9)2/h5-7H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | PFJLZLPNFBPZGN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |