C12H9ClN4 — CID 84631736
(9-chloropyrimido[4,5-b]quinolin-2-yl)methanamine (PubChem CID 84631736) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is (9-chloropyrimido[4,5-b]quinolin-2-yl)methanamine.
| Compound Name | (9-chloropyrimido[4,5-b]quinolin-2-yl)methanamine |
|---|---|
| PubChem CID | 84631736 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (9-chloropyrimido[4,5-b]quinolin-2-yl)methanamine |
| SMILES | NCc1ncc2cc3cccc(Cl)c3nc2n1 |
| InChI | InChI=1S/C12H9ClN4/c13-9-3-1-2-7-4-8-6-15-10(5-14)16-12(8)17-11(7)9/h1-4,6H,5,14H2 |
| InChIKey | NMCLOSZBJUHPOX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|