About 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile
2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile (PubChem CID 84632583) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile |
| PubChem CID | 84632583 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile |
| SMILES | CC(C)c1cccc2c1N(C)C(CC#N)CS2 |
| InChI | InChI=1S/C14H18N2S/c1-10(2)12-5-4-6-13-14(12)16(3)11(7-8-15)9-17-13/h4-6,10-11H,7,9H2,1-3H3 |
| InChIKey | RPMVMFOSURMNKL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile?
The IUPAC name of 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile (CID 84632583) is 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile.
What is the SMILES notation for 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile?
The canonical SMILES for 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile is CC(C)c1cccc2c1N(C)C(CC#N)CS2.
What is the InChIKey of 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile?
The InChIKey is RPMVMFOSURMNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c1-10(2)12-5-4-6-13-14(12)16(3)11(7-8-15)9-17-13/h4-6,10-11H,7,9H2,1-3H3.
What are the key properties of 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile?
2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile has a molecular weight of 246.38 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzothiazin-3-yl)acetonitrile is sourced from PubChem (CID 84632583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).