C14H17ClN2 — CID 84633326
5-chloro-1,3-dimethyl-2-pyrrolidin-3-ylindole (PubChem CID 84633326) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-2-pyrrolidin-3-ylindole.
| Compound Name | 5-chloro-1,3-dimethyl-2-pyrrolidin-3-ylindole |
|---|---|
| PubChem CID | 84633326 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-chloro-1,3-dimethyl-2-pyrrolidin-3-ylindole |
| SMILES | Cc1c(C2CCNC2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H17ClN2/c1-9-12-7-11(15)3-4-13(12)17(2)14(9)10-5-6-16-8-10/h3-4,7,10,16H,5-6,8H2,1-2H3 |
| InChIKey | YJKDSWBVJLWSNX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|