About 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one
3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 84633760) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 84633760 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)NC(CCN)C2 |
| InChI | InChI=1S/C13H18N2O3/c1-17-11-6-8-5-9(3-4-14)15-13(16)10(8)7-12(11)18-2/h6-7,9H,3-5,14H2,1-2H3,(H,15,16) |
| InChIKey | DWSUFCSJUCYLKA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one (CID 84633760) is 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one is COc1cc2c(cc1OC)C(=O)NC(CCN)C2.
What is the InChIKey of 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is DWSUFCSJUCYLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-17-11-6-8-5-9(3-4-14)15-13(16)10(8)7-12(11)18-2/h6-7,9H,3-5,14H2,1-2H3,(H,15,16).
What are the key properties of 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 250.30 g/mol, XLogP of 0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 84633760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).