About 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline
4-(1,5,7-trimethylbenzimidazol-2-yl)aniline (PubChem CID 84634338) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline.
Molecular Properties
| Compound Name | 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline |
| PubChem CID | 84634338 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline |
| SMILES | Cc1cc(C)c2c(c1)nc(-c1ccc(N)cc1)n2C |
| InChI | InChI=1S/C16H17N3/c1-10-8-11(2)15-14(9-10)18-16(19(15)3)12-4-6-13(17)7-5-12/h4-9H,17H2,1-3H3 |
| InChIKey | TUICYMGFJGNWOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline?
The IUPAC name of 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline (CID 84634338) is 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline.
What is the SMILES notation for 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline?
The canonical SMILES for 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline is Cc1cc(C)c2c(c1)nc(-c1ccc(N)cc1)n2C.
What is the InChIKey of 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline?
The InChIKey is TUICYMGFJGNWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-10-8-11(2)15-14(9-10)18-16(19(15)3)12-4-6-13(17)7-5-12/h4-9H,17H2,1-3H3.
What are the key properties of 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline?
4-(1,5,7-trimethylbenzimidazol-2-yl)aniline has a molecular weight of 251.33 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,5,7-trimethylbenzimidazol-2-yl)aniline is sourced from PubChem (CID 84634338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).