About 2-bromo-1,3,4,6-tetramethylindole
2-bromo-1,3,4,6-tetramethylindole (PubChem CID 84634563) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 2-bromo-1,3,4,6-tetramethylindole.
Molecular Properties
| Compound Name | 2-bromo-1,3,4,6-tetramethylindole |
| PubChem CID | 84634563 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-bromo-1,3,4,6-tetramethylindole |
| SMILES | Cc1cc(C)c2c(C)c(Br)n(C)c2c1 |
| InChI | InChI=1S/C12H14BrN/c1-7-5-8(2)11-9(3)12(13)14(4)10(11)6-7/h5-6H,1-4H3 |
| InChIKey | MBHGBIFFEABRPZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-1,3,4,6-tetramethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3,4,6-tetramethylindole?
The IUPAC name of 2-bromo-1,3,4,6-tetramethylindole (CID 84634563) is 2-bromo-1,3,4,6-tetramethylindole.
What is the SMILES notation for 2-bromo-1,3,4,6-tetramethylindole?
The canonical SMILES for 2-bromo-1,3,4,6-tetramethylindole is Cc1cc(C)c2c(C)c(Br)n(C)c2c1.
What is the InChIKey of 2-bromo-1,3,4,6-tetramethylindole?
The InChIKey is MBHGBIFFEABRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c1-7-5-8(2)11-9(3)12(13)14(4)10(11)6-7/h5-6H,1-4H3.
What are the key properties of 2-bromo-1,3,4,6-tetramethylindole?
2-bromo-1,3,4,6-tetramethylindole has a molecular weight of 252.15 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3,4,6-tetramethylindole is sourced from PubChem (CID 84634563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).