C17H22N2 — CID 84635413
1,2,4,6-tetramethyl-3-(1,2,3,6-tetrahydropyridin-4-yl)indole (PubChem CID 84635413) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1,2,4,6-tetramethyl-3-(1,2,3,6-tetrahydropyridin-4-yl)indole.
| Compound Name | 1,2,4,6-tetramethyl-3-(1,2,3,6-tetrahydropyridin-4-yl)indole |
|---|---|
| PubChem CID | 84635413 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1,2,4,6-tetramethyl-3-(1,2,3,6-tetrahydropyridin-4-yl)indole |
| SMILES | Cc1cc(C)c2c(C3=CCNCC3)c(C)n(C)c2c1 |
| InChI | InChI=1S/C17H22N2/c1-11-9-12(2)16-15(10-11)19(4)13(3)17(16)14-5-7-18-8-6-14/h5,9-10,18H,6-8H2,1-4H3 |
| InChIKey | LRWPWRKAHIKBRP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |