About 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one
5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 84635535) has the molecular formula C10H11BrN2O
and a molecular weight of 255.11 g/mol. Its IUPAC name is 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 84635535 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CCC1Nc2c(Br)cccc2NC1=O |
| InChI | InChI=1S/C10H11BrN2O/c1-2-7-10(14)13-8-5-3-4-6(11)9(8)12-7/h3-5,7,12H,2H2,1H3,(H,13,14) |
| InChIKey | QGEPFASMRQNRMF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one (CID 84635535) is 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one is CCC1Nc2c(Br)cccc2NC1=O.
What is the InChIKey of 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is QGEPFASMRQNRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O/c1-2-7-10(14)13-8-5-3-4-6(11)9(8)12-7/h3-5,7,12H,2H2,1H3,(H,13,14).
What are the key properties of 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one?
5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 255.11 g/mol, XLogP of 2.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-ethyl-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 84635535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).