About (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine
(5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine (PubChem CID 84635550) has the molecular formula C9H11BrN4
and a molecular weight of 255.12 g/mol. Its IUPAC name is (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine.
Molecular Properties
| Compound Name | (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine |
| PubChem CID | 84635550 |
| Molecular Formula | C9H11BrN4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine |
| SMILES | Cc1cc(Br)cc2nc(NN)n(C)c12 |
| InChI | InChI=1S/C9H11BrN4/c1-5-3-6(10)4-7-8(5)14(2)9(12-7)13-11/h3-4H,11H2,1-2H3,(H,12,13) |
| InChIKey | WIUWTLRHUSBRCV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine?
The IUPAC name of (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine (CID 84635550) is (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine.
What is the SMILES notation for (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine?
The canonical SMILES for (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine is Cc1cc(Br)cc2nc(NN)n(C)c12.
What is the InChIKey of (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine?
The InChIKey is WIUWTLRHUSBRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN4/c1-5-3-6(10)4-7-8(5)14(2)9(12-7)13-11/h3-4H,11H2,1-2H3,(H,12,13).
What are the key properties of (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine?
(5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine has a molecular weight of 255.12 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-1,7-dimethylbenzimidazol-2-yl)hydrazine is sourced from PubChem (CID 84635550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).