C16H20N2O — CID 84636107
3-(2,3-dihydro-1H-benzo[f][1,4]benzoxazin-2-yl)-N-methylpropan-1-amine (PubChem CID 84636107) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-benzo[f][1,4]benzoxazin-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-benzo[f][1,4]benzoxazin-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 84636107 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-benzo[f][1,4]benzoxazin-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1COc2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C16H20N2O/c1-17-10-4-6-13-11-19-15-9-8-12-5-2-3-7-14(12)16(15)18-13/h2-3,5,7-9,13,17-18H,4,6,10-11H2,1H3 |
| InChIKey | OJLRVEYJJZSZST-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|