About 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine
7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 84636914) has the molecular formula C10H12BrNS
and a molecular weight of 258.18 g/mol. Its IUPAC name is 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 84636914 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CCC1CNc2ccc(Br)cc2S1 |
| InChI | InChI=1S/C10H12BrNS/c1-2-8-6-12-9-4-3-7(11)5-10(9)13-8/h3-5,8,12H,2,6H2,1H3 |
| InChIKey | WRIVRLADMZVGPS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine (CID 84636914) is 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine is CCC1CNc2ccc(Br)cc2S1.
What is the InChIKey of 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is WRIVRLADMZVGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNS/c1-2-8-6-12-9-4-3-7(11)5-10(9)13-8/h3-5,8,12H,2,6H2,1H3.
What are the key properties of 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine?
7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 258.18 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-ethyl-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 84636914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).