About 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile
4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile (PubChem CID 84636963) has the molecular formula C11H9F3N2S
and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile |
| PubChem CID | 84636963 |
| Molecular Formula | C11H9F3N2S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile |
| SMILES | CN1c2ccc(C(F)(F)F)cc2SCC1C#N |
| InChI | InChI=1S/C11H9F3N2S/c1-16-8(5-15)6-17-10-4-7(11(12,13)14)2-3-9(10)16/h2-4,8H,6H2,1H3 |
| InChIKey | VGYIETZIVYRDQW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile?
The IUPAC name of 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile (CID 84636963) is 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile.
What is the SMILES notation for 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile?
The canonical SMILES for 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile is CN1c2ccc(C(F)(F)F)cc2SCC1C#N.
What is the InChIKey of 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile?
The InChIKey is VGYIETZIVYRDQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2S/c1-16-8(5-15)6-17-10-4-7(11(12,13)14)2-3-9(10)16/h2-4,8H,6H2,1H3.
What are the key properties of 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile?
4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile has a molecular weight of 258.27 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazine-3-carbonitrile is sourced from PubChem (CID 84636963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).