C16H21NO2 — CID 84637841
3-(7-ethyl-2-methyl-1H-indol-3-yl)-3-methylbutanoic acid (PubChem CID 84637841) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(7-ethyl-2-methyl-1H-indol-3-yl)-3-methylbutanoic acid.
| Compound Name | 3-(7-ethyl-2-methyl-1H-indol-3-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 84637841 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 3-(7-ethyl-2-methyl-1H-indol-3-yl)-3-methylbutanoic acid |
| SMILES | CCc1cccc2c(C(C)(C)CC(=O)O)c(C)[nH]c12 |
| InChI | InChI=1S/C16H21NO2/c1-5-11-7-6-8-12-14(10(2)17-15(11)12)16(3,4)9-13(18)19/h6-8,17H,5,9H2,1-4H3,(H,18,19) |
| InChIKey | BEPBNMCCIBVHQF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |