About (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid
(2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (PubChem CID 84638800) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid.
Molecular Properties
| Compound Name | (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| PubChem CID | 84638800 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid |
| SMILES | COc1cc2c(cc1OC)/C(=C/C(=O)O)C(C)CC2 |
| InChI | InChI=1S/C15H18O4/c1-9-4-5-10-6-13(18-2)14(19-3)7-12(10)11(9)8-15(16)17/h6-9H,4-5H2,1-3H3,(H,16,17)/b11-8+ |
| InChIKey | JIFNYOCSCSEMCV-DHZHZOJOSA-N |
| XLogP | 2.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid?
The IUPAC name of (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid (CID 84638800) is (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid.
What is the SMILES notation for (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid?
The canonical SMILES for (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid is COc1cc2c(cc1OC)/C(=C/C(=O)O)C(C)CC2.
What is the InChIKey of (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid?
The InChIKey is JIFNYOCSCSEMCV-DHZHZOJOSA-N. The full InChI is InChI=1S/C15H18O4/c1-9-4-5-10-6-13(18-2)14(19-3)7-12(10)11(9)8-15(16)17/h6-9H,4-5H2,1-3H3,(H,16,17)/b11-8+.
What are the key properties of (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid?
(2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid has a molecular weight of 262.31 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetic acid is sourced from PubChem (CID 84638800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).