C15H22N2O2 — CID 84638892
N-methyl-2-(6-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-9-yl)ethanamine (PubChem CID 84638892) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-methyl-2-(6-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-9-yl)ethanamine.
| Compound Name | N-methyl-2-(6-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-9-yl)ethanamine |
|---|---|
| PubChem CID | 84638892 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-methyl-2-(6-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-9-yl)ethanamine |
| SMILES | CNCCC1CCN(C)c2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C15H22N2O2/c1-16-5-3-11-4-6-17(2)13-10-15-14(9-12(11)13)18-7-8-19-15/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | CEVJWWASXGMVFR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|