C14H12N4O2 — CID 84640678
2-(13,15-dioxa-2,4,6-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11,16-heptaen-5-yl)ethanamine (PubChem CID 84640678) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-(13,15-dioxa-2,4,6-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11,16-heptaen-5-yl)ethanamine.
| Compound Name | 2-(13,15-dioxa-2,4,6-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11,16-heptaen-5-yl)ethanamine |
|---|---|
| PubChem CID | 84640678 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(13,15-dioxa-2,4,6-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11,16-heptaen-5-yl)ethanamine |
| SMILES | NCCc1ncc2cc3cc4c(cc3nc2n1)OCO4 |
| InChI | InChI=1S/C14H12N4O2/c15-2-1-13-16-6-9-3-8-4-11-12(20-7-19-11)5-10(8)17-14(9)18-13/h3-6H,1-2,7,15H2 |
| InChIKey | LWBPAFDLCZVKHG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|