C13H20N2O2S — CID 84640819
3,3,5,6-tetramethyl-4-methylsulfonyl-1,2-dihydroquinoxaline (PubChem CID 84640819) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3,3,5,6-tetramethyl-4-methylsulfonyl-1,2-dihydroquinoxaline.
| Compound Name | 3,3,5,6-tetramethyl-4-methylsulfonyl-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 84640819 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3,3,5,6-tetramethyl-4-methylsulfonyl-1,2-dihydroquinoxaline |
| SMILES | Cc1ccc2c(c1C)N(S(C)(=O)=O)C(C)(C)CN2 |
| InChI | InChI=1S/C13H20N2O2S/c1-9-6-7-11-12(10(9)2)15(18(5,16)17)13(3,4)8-14-11/h6-7,14H,8H2,1-5H3 |
| InChIKey | SAOJAEYKTUBUCM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |