About 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine
3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine (PubChem CID 84640986) has the molecular formula C13H20N2S2
and a molecular weight of 268.45 g/mol. Its IUPAC name is 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine |
| PubChem CID | 84640986 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine |
| SMILES | CSc1ccc2c(c1)SCC(C)N2CCCN |
| InChI | InChI=1S/C13H20N2S2/c1-10-9-17-13-8-11(16-2)4-5-12(13)15(10)7-3-6-14/h4-5,8,10H,3,6-7,9,14H2,1-2H3 |
| InChIKey | VMBFGMGBLIXYHN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine?
The IUPAC name of 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine (CID 84640986) is 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine.
What is the SMILES notation for 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine?
The canonical SMILES for 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine is CSc1ccc2c(c1)SCC(C)N2CCCN.
What is the InChIKey of 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine?
The InChIKey is VMBFGMGBLIXYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S2/c1-10-9-17-13-8-11(16-2)4-5-12(13)15(10)7-3-6-14/h4-5,8,10H,3,6-7,9,14H2,1-2H3.
What are the key properties of 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine?
3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine has a molecular weight of 268.45 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-7-methylsulfanyl-2,3-dihydro-1,4-benzothiazin-4-yl)propan-1-amine is sourced from PubChem (CID 84640986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).