About 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid
8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid (PubChem CID 84641705) has the molecular formula C10H10BrNO3
and a molecular weight of 272.10 g/mol. Its IUPAC name is 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid |
| PubChem CID | 84641705 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid |
| SMILES | CN1c2cccc(Br)c2OCC1C(=O)O |
| InChI | InChI=1S/C10H10BrNO3/c1-12-7-4-2-3-6(11)9(7)15-5-8(12)10(13)14/h2-4,8H,5H2,1H3,(H,13,14) |
| InChIKey | VLJGSAUYJRZBJD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid?
The IUPAC name of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid (CID 84641705) is 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid.
What is the SMILES notation for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid?
The canonical SMILES for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid is CN1c2cccc(Br)c2OCC1C(=O)O.
What is the InChIKey of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid?
The InChIKey is VLJGSAUYJRZBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO3/c1-12-7-4-2-3-6(11)9(7)15-5-8(12)10(13)14/h2-4,8H,5H2,1H3,(H,13,14).
What are the key properties of 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid?
8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid has a molecular weight of 272.10 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine-3-carboxylic acid is sourced from PubChem (CID 84641705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).