C18H24O2 — CID 84641775
(2E)-2-(7-tert-butyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid (PubChem CID 84641775) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2E)-2-(7-tert-butyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid.
| Compound Name | (2E)-2-(7-tert-butyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 84641775 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2E)-2-(7-tert-butyl-4,4-dimethyl-2,3-dihydronaphthalen-1-ylidene)acetic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)/C(=C/C(=O)O)CCC2(C)C |
| InChI | InChI=1S/C18H24O2/c1-17(2,3)13-6-7-15-14(11-13)12(10-16(19)20)8-9-18(15,4)5/h6-7,10-11H,8-9H2,1-5H3,(H,19,20)/b12-10+ |
| InChIKey | FSZMXHNPWOIAIV-ZRDIBKRKSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|