C13H12ClNO4 — CID 84642929
2-(7-chloro-6-methoxy-1-methyl-2-oxoquinolin-3-yl)acetic acid (PubChem CID 84642929) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is 2-(7-chloro-6-methoxy-1-methyl-2-oxoquinolin-3-yl)acetic acid.
| Compound Name | 2-(7-chloro-6-methoxy-1-methyl-2-oxoquinolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 84642929 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-(7-chloro-6-methoxy-1-methyl-2-oxoquinolin-3-yl)acetic acid |
| SMILES | COc1cc2cc(CC(=O)O)c(=O)n(C)c2cc1Cl |
| InChI | InChI=1S/C13H12ClNO4/c1-15-10-6-9(14)11(19-2)4-7(10)3-8(13(15)18)5-12(16)17/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | OMLCYCPONCXHHH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |