About 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine
3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine (PubChem CID 84643454) has the molecular formula C12H17BrN2O
and a molecular weight of 285.18 g/mol. Its IUPAC name is 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine |
| PubChem CID | 84643454 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine |
| SMILES | NCCCN1CCOc2c(Br)cccc2C1 |
| InChI | InChI=1S/C12H17BrN2O/c13-11-4-1-3-10-9-15(6-2-5-14)7-8-16-12(10)11/h1,3-4H,2,5-9,14H2 |
| InChIKey | GLTDHHUDSLXTSK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine?
The IUPAC name of 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine (CID 84643454) is 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine.
What is the SMILES notation for 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine?
The canonical SMILES for 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine is NCCCN1CCOc2c(Br)cccc2C1.
What is the InChIKey of 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine?
The InChIKey is GLTDHHUDSLXTSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O/c13-11-4-1-3-10-9-15(6-2-5-14)7-8-16-12(10)11/h1,3-4H,2,5-9,14H2.
What are the key properties of 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine?
3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine has a molecular weight of 285.18 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9-bromo-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)propan-1-amine is sourced from PubChem (CID 84643454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).