About 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole
3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole (PubChem CID 84644830) has the molecular formula C12H11BrF3N
and a molecular weight of 306.13 g/mol. Its IUPAC name is 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole.
Molecular Properties
| Compound Name | 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole |
| PubChem CID | 84644830 |
| Molecular Formula | C12H11BrF3N |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole |
| SMILES | Cc1cc(C)c2c(c1)c(Br)c(C(F)(F)F)n2C |
| InChI | InChI=1S/C12H11BrF3N/c1-6-4-7(2)10-8(5-6)9(13)11(17(10)3)12(14,15)16/h4-5H,1-3H3 |
| InChIKey | HONPLAAAEPSOHN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole?
The IUPAC name of 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole (CID 84644830) is 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole.
What is the SMILES notation for 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole?
The canonical SMILES for 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole is Cc1cc(C)c2c(c1)c(Br)c(C(F)(F)F)n2C.
What is the InChIKey of 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole?
The InChIKey is HONPLAAAEPSOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrF3N/c1-6-4-7(2)10-8(5-6)9(13)11(17(10)3)12(14,15)16/h4-5H,1-3H3.
What are the key properties of 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole?
3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole has a molecular weight of 306.13 g/mol, XLogP of 4.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,5,7-trimethyl-2-(trifluoromethyl)indole is sourced from PubChem (CID 84644830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).