About 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine
3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine (PubChem CID 84645581) has the molecular formula C13H19BrN2S
and a molecular weight of 315.28 g/mol. Its IUPAC name is 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine |
| PubChem CID | 84645581 |
| Molecular Formula | C13H19BrN2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1CSc2cccc(Br)c2N1C |
| InChI | InChI=1S/C13H19BrN2S/c1-15-8-4-5-10-9-17-12-7-3-6-11(14)13(12)16(10)2/h3,6-7,10,15H,4-5,8-9H2,1-2H3 |
| InChIKey | NQTOOZPWMHAMJY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine?
The IUPAC name of 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine (CID 84645581) is 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine.
What is the SMILES notation for 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine?
The canonical SMILES for 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine is CNCCCC1CSc2cccc(Br)c2N1C.
What is the InChIKey of 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine?
The InChIKey is NQTOOZPWMHAMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN2S/c1-15-8-4-5-10-9-17-12-7-3-6-11(14)13(12)16(10)2/h3,6-7,10,15H,4-5,8-9H2,1-2H3.
What are the key properties of 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine?
3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine has a molecular weight of 315.28 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazin-3-yl)-N-methylpropan-1-amine is sourced from PubChem (CID 84645581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).