C15H20BrN3 — CID 84646013
6-bromo-1,4-dimethyl-2-(piperidin-2-ylmethyl)benzimidazole (PubChem CID 84646013) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is 6-bromo-1,4-dimethyl-2-(piperidin-2-ylmethyl)benzimidazole.
| Compound Name | 6-bromo-1,4-dimethyl-2-(piperidin-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 84646013 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6-bromo-1,4-dimethyl-2-(piperidin-2-ylmethyl)benzimidazole |
| SMILES | Cc1cc(Br)cc2c1nc(CC1CCCCN1)n2C |
| InChI | InChI=1S/C15H20BrN3/c1-10-7-11(16)8-13-15(10)18-14(19(13)2)9-12-5-3-4-6-17-12/h7-8,12,17H,3-6,9H2,1-2H3 |
| InChIKey | CLOBGRCKJDBLJW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |