About 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid
3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid (PubChem CID 84646217) has the molecular formula C13H15BrN2O3
and a molecular weight of 327.18 g/mol. Its IUPAC name is 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid |
| PubChem CID | 84646217 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid |
| SMILES | Cc1cc(Br)cc2c1NC(=O)CCN2CCC(=O)O |
| InChI | InChI=1S/C13H15BrN2O3/c1-8-6-9(14)7-10-13(8)15-11(17)2-4-16(10)5-3-12(18)19/h6-7H,2-5H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | BOFMKZGYOHYTBC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid?
The IUPAC name of 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid (CID 84646217) is 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid.
What is the SMILES notation for 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid?
The canonical SMILES for 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid is Cc1cc(Br)cc2c1NC(=O)CCN2CCC(=O)O.
What is the InChIKey of 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid?
The InChIKey is BOFMKZGYOHYTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O3/c1-8-6-9(14)7-10-13(8)15-11(17)2-4-16(10)5-3-12(18)19/h6-7H,2-5H2,1H3,(H,15,17)(H,18,19).
What are the key properties of 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid?
3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid has a molecular weight of 327.18 g/mol, XLogP of 2.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-bromo-6-methyl-4-oxo-3,5-dihydro-2H-1,5-benzodiazepin-1-yl)propanoic acid is sourced from PubChem (CID 84646217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).