C16H22BrN3 — CID 84646607
2-bromo-1,6-dimethyl-3-[(1-methylpiperazin-2-yl)methyl]indole (PubChem CID 84646607) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-bromo-1,6-dimethyl-3-[(1-methylpiperazin-2-yl)methyl]indole.
| Compound Name | 2-bromo-1,6-dimethyl-3-[(1-methylpiperazin-2-yl)methyl]indole |
|---|---|
| PubChem CID | 84646607 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-bromo-1,6-dimethyl-3-[(1-methylpiperazin-2-yl)methyl]indole |
| SMILES | Cc1ccc2c(CC3CNCCN3C)c(Br)n(C)c2c1 |
| InChI | InChI=1S/C16H22BrN3/c1-11-4-5-13-14(16(17)20(3)15(13)8-11)9-12-10-18-6-7-19(12)2/h4-5,8,12,18H,6-7,9-10H2,1-3H3 |
| InChIKey | YQROXBPUVFTQJA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |