About 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine
3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine (PubChem CID 84647022) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine.
Analyze 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine?
The IUPAC name of 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine (CID 84647022) is 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine.
What is the SMILES notation for 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine?
The canonical SMILES for 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine is CCc1n[nH]c2c1NCCC2.
What is the InChIKey of 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine?
The InChIKey is PIRGYGBZUYCVOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-6-8-7(11-10-6)4-3-5-9-8/h9H,2-5H2,1H3,(H,10,11).
What are the key properties of 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine?
3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine has a molecular weight of 151.21 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 84647022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).